About 2-(1-phenylhex-1-enyl)-1,3-thiazole
2-(1-phenylhex-1-enyl)-1,3-thiazole (PubChem CID 71123881) has the molecular formula C15H17NS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 2-(1-phenylhex-1-enyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1-phenylhex-1-enyl)-1,3-thiazole |
| PubChem CID | 71123881 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(1-phenylhex-1-enyl)-1,3-thiazole |
| SMILES | CCCCC=C(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C15H17NS/c1-2-3-5-10-14(15-16-11-12-17-15)13-8-6-4-7-9-13/h4,6-12H,2-3,5H2,1H3 |
| InChIKey | CTZRFZXCDCCEBD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-phenylhex-1-enyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylhex-1-enyl)-1,3-thiazole?
The IUPAC name of 2-(1-phenylhex-1-enyl)-1,3-thiazole (CID 71123881) is 2-(1-phenylhex-1-enyl)-1,3-thiazole.
What is the SMILES notation for 2-(1-phenylhex-1-enyl)-1,3-thiazole?
The canonical SMILES for 2-(1-phenylhex-1-enyl)-1,3-thiazole is CCCCC=C(c1ccccc1)c1nccs1.
What is the InChIKey of 2-(1-phenylhex-1-enyl)-1,3-thiazole?
The InChIKey is CTZRFZXCDCCEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NS/c1-2-3-5-10-14(15-16-11-12-17-15)13-8-6-4-7-9-13/h4,6-12H,2-3,5H2,1H3.
What are the key properties of 2-(1-phenylhex-1-enyl)-1,3-thiazole?
2-(1-phenylhex-1-enyl)-1,3-thiazole has a molecular weight of 243.38 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylhex-1-enyl)-1,3-thiazole is sourced from PubChem (CID 71123881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).