C19H35N5O2 — CID 71124123
(2S)-1-(4-tert-butylpiperazin-1-yl)-3-hydroxy-2-(4-pentyltriazol-1-yl)butan-1-one (PubChem CID 71124123) has the molecular formula C19H35N5O2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (2S)-1-(4-tert-butylpiperazin-1-yl)-3-hydroxy-2-(4-pentyltriazol-1-yl)butan-1-one.
| Compound Name | (2S)-1-(4-tert-butylpiperazin-1-yl)-3-hydroxy-2-(4-pentyltriazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 71124123 |
| Molecular Formula | C19H35N5O2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | (2S)-1-(4-tert-butylpiperazin-1-yl)-3-hydroxy-2-(4-pentyltriazol-1-yl)butan-1-one |
| SMILES | CCCCCc1cn([C@H](C(=O)N2CCN(C(C)(C)C)CC2)C(C)O)nn1 |
| InChI | InChI=1S/C19H35N5O2/c1-6-7-8-9-16-14-24(21-20-16)17(15(2)25)18(26)22-10-12-23(13-11-22)19(3,4)5/h14-15,17,25H,6-13H2,1-5H3/t15?,17-/m0/s1 |
| InChIKey | ZOJKWWHMIMVNEC-LWKPJOBUSA-N |
| XLogP | 1.88 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|