C24H28ClN5O2 — CID 71124210
4-(1H-imidazol-5-yl)butyl N-[2-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)amino]ethyl]carbamate (PubChem CID 71124210) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 4-(1H-imidazol-5-yl)butyl N-[2-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)amino]ethyl]carbamate.
| Compound Name | 4-(1H-imidazol-5-yl)butyl N-[2-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 71124210 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-(1H-imidazol-5-yl)butyl N-[2-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)amino]ethyl]carbamate |
| SMILES | O=C(NCCNC1c2ccc(Cl)cc2CCc2cccnc21)OCCCCc1cnc[nH]1 |
| InChI | InChI=1S/C24H28ClN5O2/c25-19-8-9-21-18(14-19)7-6-17-4-3-10-27-22(17)23(21)28-11-12-29-24(31)32-13-2-1-5-20-15-26-16-30-20/h3-4,8-10,14-16,23,28H,1-2,5-7,11-13H2,(H,26,30)(H,29,31) |
| InChIKey | JOKYMTGGSZCUGE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|