C28H46N2O2 — CID 71124367
1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-propylpentan-1-one (PubChem CID 71124367) has the molecular formula C28H46N2O2 and a molecular weight of 442.69 g/mol. Its IUPAC name is 1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-propylpentan-1-one.
| Compound Name | 1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-propylpentan-1-one |
|---|---|
| PubChem CID | 71124367 |
| Molecular Formula | C28H46N2O2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | 1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-propylpentan-1-one |
| SMILES | CCCC(CCC)C(=O)N1CCC(c2ccc(OCCCN3[C@H](C)CC[C@H]3C)cc2)CC1 |
| InChI | InChI=1S/C28H46N2O2/c1-5-8-26(9-6-2)28(31)29-19-16-25(17-20-29)24-12-14-27(15-13-24)32-21-7-18-30-22(3)10-11-23(30)4/h12-15,22-23,25-26H,5-11,16-21H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | LDZPTRDGPMKNPN-DHIUTWEWSA-N |
| XLogP | 6.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|