About 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate
2-(1,3-dioxoisoindol-2-yl)ethyl benzoate (PubChem CID 711247) has the molecular formula C17H13NO4
and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate |
| PubChem CID | 711247 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C17H13NO4/c19-15-13-8-4-5-9-14(13)16(20)18(15)10-11-22-17(21)12-6-2-1-3-7-12/h1-9H,10-11H2 |
| InChIKey | GGEJXUXPXPVWNW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate (CID 711247) is 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate is O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccccc1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate?
The InChIKey is GGEJXUXPXPVWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO4/c19-15-13-8-4-5-9-14(13)16(20)18(15)10-11-22-17(21)12-6-2-1-3-7-12/h1-9H,10-11H2.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate?
2-(1,3-dioxoisoindol-2-yl)ethyl benzoate has a molecular weight of 295.29 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl benzoate is sourced from PubChem (CID 711247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).