C32H34N2 — CID 71125096
N-[4-[4-(1,2,8,8a-tetrahydronaphthalen-1-ylamino)phenyl]cyclohexa-1,3-dien-1-yl]-4,4a,5,6-tetrahydronaphthalen-1-amine (PubChem CID 71125096) has the molecular formula C32H34N2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N-[4-[4-(1,2,8,8a-tetrahydronaphthalen-1-ylamino)phenyl]cyclohexa-1,3-dien-1-yl]-4,4a,5,6-tetrahydronaphthalen-1-amine.
| Compound Name | N-[4-[4-(1,2,8,8a-tetrahydronaphthalen-1-ylamino)phenyl]cyclohexa-1,3-dien-1-yl]-4,4a,5,6-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 71125096 |
| Molecular Formula | C32H34N2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[4-[4-(1,2,8,8a-tetrahydronaphthalen-1-ylamino)phenyl]cyclohexa-1,3-dien-1-yl]-4,4a,5,6-tetrahydronaphthalen-1-amine |
| SMILES | C1=CCC2C(=C1)C=CCC2Nc1ccc(C2=CC=C(NC3=C4C=CCCC4CC=C3)CC2)cc1 |
| InChI | InChI=1S/C32H34N2/c1-3-11-29-25(7-1)9-5-13-31(29)33-27-19-15-23(16-20-27)24-17-21-28(22-18-24)34-32-14-6-10-26-8-2-4-12-30(26)32/h1,3-7,9,12,14-17,19-21,26,29,31,33-34H,2,8,10-11,13,18,22H2 |
| InChIKey | SGXHOHWBLUUWJK-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |