About 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole
9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole (PubChem CID 71125181) has the molecular formula C23H26N2
and a molecular weight of 330.48 g/mol. Its IUPAC name is 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole.
Molecular Properties
| Compound Name | 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole |
| PubChem CID | 71125181 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole |
| SMILES | C/C=C\c1c(CCn2c3c(c4ccccc42)CCC=C3)c[nH]c1CC |
| InChI | InChI=1S/C23H26N2/c1-3-9-18-17(16-24-21(18)4-2)14-15-25-22-12-7-5-10-19(22)20-11-6-8-13-23(20)25/h3,5,7-10,12-13,16,24H,4,6,11,14-15H2,1-2H3/b9-3- |
| InChIKey | HAXJZLHWNGCFCL-OQFOIZHKSA-N |
| XLogP | 5.77 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole?
The IUPAC name of 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole (CID 71125181) is 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole.
What is the SMILES notation for 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole?
The canonical SMILES for 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole is C/C=C\c1c(CCn2c3c(c4ccccc42)CCC=C3)c[nH]c1CC.
What is the InChIKey of 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole?
The InChIKey is HAXJZLHWNGCFCL-OQFOIZHKSA-N. The full InChI is InChI=1S/C23H26N2/c1-3-9-18-17(16-24-21(18)4-2)14-15-25-22-12-7-5-10-19(22)20-11-6-8-13-23(20)25/h3,5,7-10,12-13,16,24H,4,6,11,14-15H2,1-2H3/b9-3-.
What are the key properties of 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole?
9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole has a molecular weight of 330.48 g/mol, XLogP of 5.77, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-[5-ethyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethyl]-3,4-dihydrocarbazole is sourced from PubChem (CID 71125181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).