C12H7Br3N2O — CID 71125528
3,5,7-tribromo-6-methoxy-9H-pyrido[2,3-b]indole (PubChem CID 71125528) has the molecular formula C12H7Br3N2O and a molecular weight of 434.91 g/mol. Its IUPAC name is 3,5,7-tribromo-6-methoxy-9H-pyrido[2,3-b]indole.
| Compound Name | 3,5,7-tribromo-6-methoxy-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 71125528 |
| Molecular Formula | C12H7Br3N2O |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 431.81 |
| IUPAC Name | 3,5,7-tribromo-6-methoxy-9H-pyrido[2,3-b]indole |
| SMILES | COc1c(Br)cc2[nH]c3ncc(Br)cc3c2c1Br |
| InChI | InChI=1S/C12H7Br3N2O/c1-18-11-7(14)3-8-9(10(11)15)6-2-5(13)4-16-12(6)17-8/h2-4H,1H3,(H,16,17) |
| InChIKey | HXRFXQNDHZUFIO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |