C17H22FN5O — CID 71125999
4-[[4-(cycloheptylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-2-fluorophenol (PubChem CID 71125999) has the molecular formula C17H22FN5O and a molecular weight of 331.39 g/mol. Its IUPAC name is 4-[[4-(cycloheptylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-2-fluorophenol.
| Compound Name | 4-[[4-(cycloheptylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-2-fluorophenol |
|---|---|
| PubChem CID | 71125999 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[[4-(cycloheptylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-2-fluorophenol |
| SMILES | Cc1nc(Nc2ccc(O)c(F)c2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C17H22FN5O/c1-11-19-16(21-12-6-4-2-3-5-7-12)23-17(20-11)22-13-8-9-15(24)14(18)10-13/h8-10,12,24H,2-7H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | JOCYNNHCACDXFP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|