C14H20O2 — CID 71126057
(4aR,9aR)-4a,8,8-trimethyl-4,6,7,9a-tetrahydroindeno[2,1-d][1,3]dioxine (PubChem CID 71126057) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4aR,9aR)-4a,8,8-trimethyl-4,6,7,9a-tetrahydroindeno[2,1-d][1,3]dioxine.
| Compound Name | (4aR,9aR)-4a,8,8-trimethyl-4,6,7,9a-tetrahydroindeno[2,1-d][1,3]dioxine |
|---|---|
| PubChem CID | 71126057 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (4aR,9aR)-4a,8,8-trimethyl-4,6,7,9a-tetrahydroindeno[2,1-d][1,3]dioxine |
| SMILES | CC1(C)CCC=C2C1=C[C@H]1OCOC[C@@]21C |
| InChI | InChI=1S/C14H20O2/c1-13(2)6-4-5-10-11(13)7-12-14(10,3)8-15-9-16-12/h5,7,12H,4,6,8-9H2,1-3H3/t12-,14+/m1/s1 |
| InChIKey | YHTFGVVRMMSXFI-OCCSQVGLSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |