C12H10O3S2 — CID 71126095
2-(1-hydroxyethyl)-2,3-dihydrothieno[3,2-f][1]benzothiole-4,8-dione (PubChem CID 71126095) has the molecular formula C12H10O3S2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-2,3-dihydrothieno[3,2-f][1]benzothiole-4,8-dione.
| Compound Name | 2-(1-hydroxyethyl)-2,3-dihydrothieno[3,2-f][1]benzothiole-4,8-dione |
|---|---|
| PubChem CID | 71126095 |
| Molecular Formula | C12H10O3S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-(1-hydroxyethyl)-2,3-dihydrothieno[3,2-f][1]benzothiole-4,8-dione |
| SMILES | CC(O)C1CC2=C(S1)C(=O)c1sccc1C2=O |
| InChI | InChI=1S/C12H10O3S2/c1-5(13)8-4-7-9(14)6-2-3-16-11(6)10(15)12(7)17-8/h2-3,5,8,13H,4H2,1H3 |
| InChIKey | FFGWVBZKPMHVPJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|