C13H19NO6 — CID 71126122
7-(furan-2-yl)-2,2,4-trimethyl-6-nitro-1,3-dioxocan-5-ol (PubChem CID 71126122) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is 7-(furan-2-yl)-2,2,4-trimethyl-6-nitro-1,3-dioxocan-5-ol.
| Compound Name | 7-(furan-2-yl)-2,2,4-trimethyl-6-nitro-1,3-dioxocan-5-ol |
|---|---|
| PubChem CID | 71126122 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 7-(furan-2-yl)-2,2,4-trimethyl-6-nitro-1,3-dioxocan-5-ol |
| SMILES | CC1OC(C)(C)OCC(c2ccco2)C([N+](=O)[O-])C1O |
| InChI | InChI=1S/C13H19NO6/c1-8-12(15)11(14(16)17)9(10-5-4-6-18-10)7-19-13(2,3)20-8/h4-6,8-9,11-12,15H,7H2,1-3H3 |
| InChIKey | GSABQIJYXWAHOU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|