C28H31N3O4 — CID 71126471
(4R,4aS,7aR,12bS)-7-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methyl-N-phenyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide (PubChem CID 71126471) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-7-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methyl-N-phenyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide.
| Compound Name | (4R,4aS,7aR,12bS)-7-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methyl-N-phenyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 71126471 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (4R,4aS,7aR,12bS)-7-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methyl-N-phenyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
| SMILES | Cc1cc2c3c(c1O)O[C@H]1C(N)=C(C(=O)Nc4ccccc4)C[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C28H31N3O4/c1-15-11-17-12-20-28(34)13-19(26(33)30-18-5-3-2-4-6-18)22(29)25-27(28,21(17)24(35-25)23(15)32)9-10-31(20)14-16-7-8-16/h2-6,11,16,20,25,32,34H,7-10,12-14,29H2,1H3,(H,30,33)/t20-,25+,27+,28-/m1/s1 |
| InChIKey | IFKIFNFZKPTEMN-RAEUPJMESA-N |
| XLogP | 2.73 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |