About 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane
2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane (PubChem CID 71126485) has the molecular formula C11H20F2O
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane.
Molecular Properties
| Compound Name | 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane |
| PubChem CID | 71126485 |
| Molecular Formula | C11H20F2O |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane |
| SMILES | CCC(C)(C)C(F)(F)C1OCCC1C |
| InChI | InChI=1S/C11H20F2O/c1-5-10(3,4)11(12,13)9-8(2)6-7-14-9/h8-9H,5-7H2,1-4H3 |
| InChIKey | MWJSDZGRXMMTFI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane?
The IUPAC name of 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane (CID 71126485) is 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane.
What is the SMILES notation for 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane?
The canonical SMILES for 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane is CCC(C)(C)C(F)(F)C1OCCC1C.
What is the InChIKey of 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane?
The InChIKey is MWJSDZGRXMMTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2O/c1-5-10(3,4)11(12,13)9-8(2)6-7-14-9/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane?
2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane has a molecular weight of 206.28 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoro-2,2-dimethylbutyl)-3-methyloxolane is sourced from PubChem (CID 71126485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).