About 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane
4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (PubChem CID 71126793) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
Analyze 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
The IUPAC name of 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (CID 71126793) is 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
The canonical SMILES for 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane is CCC1(C)OC2C3CC(C(C)C3C)C2O1.
What is the InChIKey of 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
The InChIKey is CBHXBIYRSVKJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-13(4)14-11-9-6-10(12(11)15-13)8(3)7(9)2/h7-12H,5-6H2,1-4H3.
What are the key properties of 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane?
4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane has a molecular weight of 210.32 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4,8,9-trimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 71126793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).