About oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate
oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate (PubChem CID 71127248) has the molecular formula C25H24FN3O4
and a molecular weight of 449.48 g/mol. Its IUPAC name is oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate.
Molecular Properties
| Compound Name | oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate |
| PubChem CID | 71127248 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate |
| SMILES | NCc1ccc(C(=O)Nc2ccncc2F)cc1-c1cccc(C(=O)OC2CCCOC2)c1 |
| InChI | InChI=1S/C25H24FN3O4/c26-22-14-28-9-8-23(22)29-24(30)17-6-7-19(13-27)21(12-17)16-3-1-4-18(11-16)25(31)33-20-5-2-10-32-15-20/h1,3-4,6-9,11-12,14,20H,2,5,10,13,15,27H2,(H,28,29,30) |
| InChIKey | YPZQJNJQSCNYGY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate?
The IUPAC name of oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate (CID 71127248) is oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate.
What is the SMILES notation for oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate?
The canonical SMILES for oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate is NCc1ccc(C(=O)Nc2ccncc2F)cc1-c1cccc(C(=O)OC2CCCOC2)c1.
What is the InChIKey of oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate?
The InChIKey is YPZQJNJQSCNYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24FN3O4/c26-22-14-28-9-8-23(22)29-24(30)17-6-7-19(13-27)21(12-17)16-3-1-4-18(11-16)25(31)33-20-5-2-10-32-15-20/h1,3-4,6-9,11-12,14,20H,2,5,10,13,15,27H2,(H,28,29,30).
What are the key properties of oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate?
oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate has a molecular weight of 449.48 g/mol, XLogP of 3.93, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-3-yl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate is sourced from PubChem (CID 71127248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).