C23H32N6O9 — CID 71127604
2-[[(5S,8S,11S)-8-(4-aminobutyl)-11-ethyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carbonyl]amino]acetic acid (PubChem CID 71127604) has the molecular formula C23H32N6O9 and a molecular weight of 536.54 g/mol. Its IUPAC name is 2-[[(5S,8S,11S)-8-(4-aminobutyl)-11-ethyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(5S,8S,11S)-8-(4-aminobutyl)-11-ethyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 71127604 |
| Molecular Formula | C23H32N6O9 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 2-[[(5S,8S,11S)-8-(4-aminobutyl)-11-ethyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carbonyl]amino]acetic acid |
| SMILES | CC[C@@H]1NC(=O)c2cc([N+](=O)[O-])ccc2OCC[C@@H](C(=O)NCC(=O)O)NC(=O)[C@H](CCCCN)NC1=O |
| InChI | InChI=1S/C23H32N6O9/c1-2-15-22(34)27-16(5-3-4-9-24)23(35)28-17(21(33)25-12-19(30)31)8-10-38-18-7-6-13(29(36)37)11-14(18)20(32)26-15/h6-7,11,15-17H,2-5,8-10,12,24H2,1H3,(H,25,33)(H,26,32)(H,27,34)(H,28,35)(H,30,31)/t15-,16-,17-/m0/s1 |
| InChIKey | UALCZMILOGIVPJ-ULQDDVLXSA-N |
| XLogP | -0.81 |
| TPSA | 232.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|