C33H50BrN5O4Si2 — CID 71128166
methyl 5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]pyridine-2-carboxylate (PubChem CID 71128166) has the molecular formula C33H50BrN5O4Si2 and a molecular weight of 716.87 g/mol. Its IUPAC name is methyl 5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71128166 |
| Molecular Formula | C33H50BrN5O4Si2 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | methyl 5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c(Br)c(C4C[C@H]5CC[C@@H](C4)C5)nc23)cn1 |
| InChI | InChI=1S/C33H50BrN5O4Si2/c1-41-33(40)28-11-10-25(19-35-28)27-20-36-39-31(27)37-30(26-17-23-8-9-24(16-23)18-26)29(34)32(39)38(21-42-12-14-44(2,3)4)22-43-13-15-45(5,6)7/h10-11,19-20,23-24,26H,8-9,12-18,21-22H2,1-7H3/t23-,24+,26? |
| InChIKey | IXEAFFYBIBSTGX-MAOIWGCQSA-N |
| XLogP | 8.07 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|