C32H51N5O3Si2 — CID 71128170
[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]methanol (PubChem CID 71128170) has the molecular formula C32H51N5O3Si2 and a molecular weight of 609.96 g/mol. Its IUPAC name is [5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]methanol.
| Compound Name | [5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 71128170 |
| Molecular Formula | C32H51N5O3Si2 |
| Molecular Weight | 609.96 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | [5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]methanol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(CO)nc3)cnn12 |
| InChI | InChI=1S/C32H51N5O3Si2/c1-41(2,3)13-11-39-22-36(23-40-12-14-42(4,5)6)31-18-30(27-16-24-7-8-25(15-24)17-27)35-32-29(20-34-37(31)32)26-9-10-28(21-38)33-19-26/h9-10,18-20,24-25,27,38H,7-8,11-17,21-23H2,1-6H3/t24-,25+,27? |
| InChIKey | KCXMYIRXKWLOJR-YHQISMHQSA-N |
| XLogP | 7.01 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.96 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|