C38H55N5O2SSi2 — CID 71128191
5-(3-bicyclo[3.2.1]octanyl)-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71128191) has the molecular formula C38H55N5O2SSi2 and a molecular weight of 702.13 g/mol. Its IUPAC name is 5-(3-bicyclo[3.2.1]octanyl)-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(3-bicyclo[3.2.1]octanyl)-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71128191 |
| Molecular Formula | C38H55N5O2SSi2 |
| Molecular Weight | 702.13 g/mol |
| Exact Mass | 701.36 |
| IUPAC Name | 5-(3-bicyclo[3.2.1]octanyl)-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CSc1c(C2CC3CCC(C3)C2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C38H55N5O2SSi2/c1-46-36-35(32-22-28-13-14-29(21-28)23-32)41-37-33(31-15-16-34(39-24-31)30-11-9-8-10-12-30)25-40-43(37)38(36)42(26-44-17-19-47(2,3)4)27-45-18-20-48(5,6)7/h8-12,15-16,24-25,28-29,32H,13-14,17-23,26-27H2,1-7H3 |
| InChIKey | JPDUYYWIIIWTCA-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.13 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|