C38H55N5O4SSi2 — CID 71128196
5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71128196) has the molecular formula C38H55N5O4SSi2 and a molecular weight of 734.13 g/mol. Its IUPAC name is 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71128196 |
| Molecular Formula | C38H55N5O4SSi2 |
| Molecular Weight | 734.13 g/mol |
| Exact Mass | 733.35 |
| IUPAC Name | 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(S(C)(=O)=O)c(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C38H55N5O4SSi2/c1-48(44,45)36-35(32-22-28-13-14-29(21-28)23-32)41-37-33(31-15-16-34(39-24-31)30-11-9-8-10-12-30)25-40-43(37)38(36)42(26-46-17-19-49(2,3)4)27-47-18-20-50(5,6)7/h8-12,15-16,24-25,28-29,32H,13-14,17-23,26-27H2,1-7H3/t28-,29+,32? |
| InChIKey | YQJSZIZNMQEKDO-LSICZBSXSA-N |
| XLogP | 8.59 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.13 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|