C37H52BrN5O2Si2 — CID 71128255
5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-bromo-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71128255) has the molecular formula C37H52BrN5O2Si2 and a molecular weight of 734.93 g/mol. Its IUPAC name is 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-bromo-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-bromo-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71128255 |
| Molecular Formula | C37H52BrN5O2Si2 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 733.28 |
| IUPAC Name | 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-bromo-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C37H52BrN5O2Si2/c1-46(2,3)18-16-44-25-42(26-45-17-19-47(4,5)6)37-34(38)35(31-21-27-12-13-28(20-27)22-31)41-36-32(24-40-43(36)37)30-14-15-33(39-23-30)29-10-8-7-9-11-29/h7-11,14-15,23-24,27-28,31H,12-13,16-22,25-26H2,1-6H3/t27-,28+,31? |
| InChIKey | BRXXQHGZRVEKHZ-SWRQNJEFSA-N |
| XLogP | 9.95 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|