C34H55N5O3Si2 — CID 71128285
2-[5-[5-[(5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]propan-2-ol (PubChem CID 71128285) has the molecular formula C34H55N5O3Si2 and a molecular weight of 638.02 g/mol. Its IUPAC name is 2-[5-[5-[(5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[5-[(5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 71128285 |
| Molecular Formula | C34H55N5O3Si2 |
| Molecular Weight | 638.02 g/mol |
| Exact Mass | 637.38 |
| IUPAC Name | 2-[5-[5-[(5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C4CC5CC[C@@H](C5)C4)nc23)cn1 |
| InChI | InChI=1S/C34H55N5O3Si2/c1-34(2,40)31-12-11-27(21-35-31)29-22-36-39-32(20-30(37-33(29)39)28-18-25-9-10-26(17-25)19-28)38(23-41-13-15-43(3,4)5)24-42-14-16-44(6,7)8/h11-12,20-22,25-26,28,40H,9-10,13-19,23-24H2,1-8H3/t25-,26?,28?/m0/s1 |
| InChIKey | XXYLNWWDTXZLJU-MRNPYCGKSA-N |
| XLogP | 7.74 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|