C33H53N5O4Si2 — CID 71128300
1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]ethane-1,2-diol (PubChem CID 71128300) has the molecular formula C33H53N5O4Si2 and a molecular weight of 639.99 g/mol. Its IUPAC name is 1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]ethane-1,2-diol.
| Compound Name | 1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 71128300 |
| Molecular Formula | C33H53N5O4Si2 |
| Molecular Weight | 639.99 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | 1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]ethane-1,2-diol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(C(O)CO)nc3)cnn12 |
| InChI | InChI=1S/C33H53N5O4Si2/c1-43(2,3)13-11-41-22-37(23-42-12-14-44(4,5)6)32-18-30(27-16-24-7-8-25(15-24)17-27)36-33-28(20-35-38(32)33)26-9-10-29(34-19-26)31(40)21-39/h9-10,18-20,24-25,27,31,39-40H,7-8,11-17,21-23H2,1-6H3/t24-,25+,27?,31? |
| InChIKey | IWLYOTHMINNTLL-VPIFNSMYSA-N |
| XLogP | 6.54 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.99 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|