C33H50F3N5O3Si2 — CID 71128309
1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol (PubChem CID 71128309) has the molecular formula C33H50F3N5O3Si2 and a molecular weight of 677.96 g/mol. Its IUPAC name is 1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 71128309 |
| Molecular Formula | C33H50F3N5O3Si2 |
| Molecular Weight | 677.96 g/mol |
| Exact Mass | 677.34 |
| IUPAC Name | 1-[5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(C(O)C(F)(F)F)nc3)cnn12 |
| InChI | InChI=1S/C33H50F3N5O3Si2/c1-45(2,3)13-11-43-21-40(22-44-12-14-46(4,5)6)30-18-29(26-16-23-7-8-24(15-23)17-26)39-32-27(20-38-41(30)32)25-9-10-28(37-19-25)31(42)33(34,35)36/h9-10,18-20,23-24,26,31,42H,7-8,11-17,21-22H2,1-6H3/t23-,24+,26?,31? |
| InChIKey | NZBPALMXESRKSF-GMGRHGQRSA-N |
| XLogP | 8.11 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.96 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|