C33H49BrF3N5O3Si2 — CID 71128310
1-[5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol (PubChem CID 71128310) has the molecular formula C33H49BrF3N5O3Si2 and a molecular weight of 756.86 g/mol. Its IUPAC name is 1-[5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 71128310 |
| Molecular Formula | C33H49BrF3N5O3Si2 |
| Molecular Weight | 756.86 g/mol |
| Exact Mass | 755.25 |
| IUPAC Name | 1-[5-[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromopyrazolo[1,5-a]pyrimidin-3-yl]-2-pyridinyl]-2,2,2-trifluoroethanol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(C(O)C(F)(F)F)nc3)cnn12 |
| InChI | InChI=1S/C33H49BrF3N5O3Si2/c1-46(2,3)13-11-44-20-41(21-45-12-14-47(4,5)6)32-28(34)29(25-16-22-7-8-23(15-22)17-25)40-31-26(19-39-42(31)32)24-9-10-27(38-18-24)30(43)33(35,36)37/h9-10,18-19,22-23,25,30,43H,7-8,11-17,20-21H2,1-6H3/t22-,23+,25?,30? |
| InChIKey | XCXMPVNNPGJJOO-SVNXMBMLSA-N |
| XLogP | 8.87 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.86 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|