C36H52N6O2Si2 — CID 71128322
5-(3-azabicyclo[3.2.1]octan-3-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71128322) has the molecular formula C36H52N6O2Si2 and a molecular weight of 657.02 g/mol. Its IUPAC name is 5-(3-azabicyclo[3.2.1]octan-3-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(3-azabicyclo[3.2.1]octan-3-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71128322 |
| Molecular Formula | C36H52N6O2Si2 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 656.37 |
| IUPAC Name | 5-(3-azabicyclo[3.2.1]octan-3-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(N2CC3CCC(C3)C2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C36H52N6O2Si2/c1-45(2,3)18-16-43-26-41(27-44-17-19-46(4,5)6)35-21-34(40-24-28-12-13-29(20-28)25-40)39-36-32(23-38-42(35)36)31-14-15-33(37-22-31)30-10-8-7-9-11-30/h7-11,14-15,21-23,28-29H,12-13,16-20,24-27H2,1-6H3 |
| InChIKey | CKMZNNAEDBQQEU-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 68.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|