C37H51N5O2Si2 — CID 71128330
5-[(1R,5S)-3-bicyclo[3.2.1]oct-2-enyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71128330) has the molecular formula C37H51N5O2Si2 and a molecular weight of 654.02 g/mol. Its IUPAC name is 5-[(1R,5S)-3-bicyclo[3.2.1]oct-2-enyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1R,5S)-3-bicyclo[3.2.1]oct-2-enyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71128330 |
| Molecular Formula | C37H51N5O2Si2 |
| Molecular Weight | 654.02 g/mol |
| Exact Mass | 653.36 |
| IUPAC Name | 5-[(1R,5S)-3-bicyclo[3.2.1]oct-2-enyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2=C[C@@H]3CC[C@H](C2)C3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C37H51N5O2Si2/c1-45(2,3)18-16-43-26-41(27-44-17-19-46(4,5)6)36-23-35(32-21-28-12-13-29(20-28)22-32)40-37-33(25-39-42(36)37)31-14-15-34(38-24-31)30-10-8-7-9-11-30/h7-11,14-15,21,23-25,28-29H,12-13,16-20,22,26-27H2,1-6H3/t28-,29+/m1/s1 |
| InChIKey | UMZASHFUQAUVSW-WDYNHAJCSA-N |
| XLogP | 9.09 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.02 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|