C41H60N6O6SSi2 — CID 71128344
tert-butyl 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3,3-dioxo-3λ6-thia-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 71128344) has the molecular formula C41H60N6O6SSi2 and a molecular weight of 821.21 g/mol. Its IUPAC name is tert-butyl 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3,3-dioxo-3λ6-thia-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3,3-dioxo-3λ6-thia-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 71128344 |
| Molecular Formula | C41H60N6O6SSi2 |
| Molecular Weight | 821.21 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | tert-butyl 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3,3-dioxo-3λ6-thia-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC(c3cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n4ncc(-c5ccc(-c6ccccc6)nc5)c4n3)CC1CS(=O)(=O)C2 |
| InChI | InChI=1S/C41H60N6O6SSi2/c1-41(2,3)53-40(48)46-33-21-32(22-34(46)27-54(49,50)26-33)37-23-38(45(28-51-17-19-55(4,5)6)29-52-18-20-56(7,8)9)47-39(44-37)35(25-43-47)31-15-16-36(42-24-31)30-13-11-10-12-14-30/h10-16,23-25,32-34H,17-22,26-29H2,1-9H3 |
| InChIKey | OSVVLSHZMRTMBZ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 128.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.21 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|