C38H54BrN5O2Si2 — CID 71128352
6-bromo-5-(6-methyl-3-bicyclo[3.2.1]octanyl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71128352) has the molecular formula C38H54BrN5O2Si2 and a molecular weight of 748.96 g/mol. Its IUPAC name is 6-bromo-5-(6-methyl-3-bicyclo[3.2.1]octanyl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-bromo-5-(6-methyl-3-bicyclo[3.2.1]octanyl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71128352 |
| Molecular Formula | C38H54BrN5O2Si2 |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 747.30 |
| IUPAC Name | 6-bromo-5-(6-methyl-3-bicyclo[3.2.1]octanyl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC1CC2CC(c3nc4c(-c5ccc(-c6ccccc6)nc5)cnn4c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c3Br)CC1C2 |
| InChI | InChI=1S/C38H54BrN5O2Si2/c1-27-19-28-20-31(27)22-32(21-28)36-35(39)38(43(25-45-15-17-47(2,3)4)26-46-16-18-48(5,6)7)44-37(42-36)33(24-41-44)30-13-14-34(40-23-30)29-11-9-8-10-12-29/h8-14,23-24,27-28,31-32H,15-22,25-26H2,1-7H3 |
| InChIKey | WYSVFMQWDYCRJX-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|