About 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid
2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid (PubChem CID 71128932) has the molecular formula C19H22FNO3
and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid |
| PubChem CID | 71128932 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid |
| SMILES | NC(=O)C1C2CC3C1CCC(CC(=O)O)(c1ccc(F)cc1)C3C2 |
| InChI | InChI=1S/C19H22FNO3/c20-12-3-1-11(2-4-12)19(9-16(22)23)6-5-13-14-7-10(8-15(14)19)17(13)18(21)24/h1-4,10,13-15,17H,5-9H2,(H2,21,24)(H,22,23) |
| InChIKey | XTMANMFISIUOGM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid?
The IUPAC name of 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid (CID 71128932) is 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid.
What is the SMILES notation for 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid?
The canonical SMILES for 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid is NC(=O)C1C2CC3C1CCC(CC(=O)O)(c1ccc(F)cc1)C3C2.
What is the InChIKey of 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid?
The InChIKey is XTMANMFISIUOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO3/c20-12-3-1-11(2-4-12)19(9-16(22)23)6-5-13-14-7-10(8-15(14)19)17(13)18(21)24/h1-4,10,13-15,17H,5-9H2,(H2,21,24)(H,22,23).
What are the key properties of 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid?
2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid has a molecular weight of 331.39 g/mol, XLogP of 2.71, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[10-carbamoyl-4-(4-fluorophenyl)-4-tricyclo[5.2.1.03,8]decanyl]acetic acid is sourced from PubChem (CID 71128932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).