C23H35N7O — CID 71129107
4-[[4-(cycloheptylamino)-6-[methyl(piperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]-2-methylphenol (PubChem CID 71129107) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-[[4-(cycloheptylamino)-6-[methyl(piperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]-2-methylphenol.
| Compound Name | 4-[[4-(cycloheptylamino)-6-[methyl(piperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 71129107 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 4-[[4-(cycloheptylamino)-6-[methyl(piperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]-2-methylphenol |
| SMILES | Cc1cc(Nc2nc(NC3CCCCCC3)nc(N(C)C3CCNCC3)n2)ccc1O |
| InChI | InChI=1S/C23H35N7O/c1-16-15-18(9-10-20(16)31)26-22-27-21(25-17-7-5-3-4-6-8-17)28-23(29-22)30(2)19-11-13-24-14-12-19/h9-10,15,17,19,24,31H,3-8,11-14H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | BUCGBFLNTRQCOP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|