About ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate
ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate (PubChem CID 71129274) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate |
| PubChem CID | 71129274 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C2=CCCN2N(CCC(C)C)C1=O |
| InChI | InChI=1S/C15H22N2O4/c1-4-21-15(20)12-13(18)11-6-5-8-16(11)17(14(12)19)9-7-10(2)3/h6,10,18H,4-5,7-9H2,1-3H3 |
| InChIKey | ZVBMSWZCKFIBTP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate?
The IUPAC name of ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate (CID 71129274) is ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate is CCOC(=O)C1=C(O)C2=CCCN2N(CCC(C)C)C1=O.
What is the InChIKey of ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate?
The InChIKey is ZVBMSWZCKFIBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-4-21-15(20)12-13(18)11-6-5-8-16(11)17(14(12)19)9-7-10(2)3/h6,10,18H,4-5,7-9H2,1-3H3.
What are the key properties of ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate?
ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate has a molecular weight of 294.35 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-1-(3-methylbutyl)-2-oxo-6,7-dihydropyrrolo[1,2-b]pyridazine-3-carboxylate is sourced from PubChem (CID 71129274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).