C24H23N3O6 — CID 71129379
5-anilino-2-[4-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanoic acid (PubChem CID 71129379) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 5-anilino-2-[4-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-anilino-2-[4-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71129379 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-anilino-2-[4-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanoic acid |
| SMILES | O=C(CCC(C(=O)O)N1C(=O)c2cccc(NCC3CC=CO3)c2C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H23N3O6/c28-20(26-15-6-2-1-3-7-15)12-11-19(24(31)32)27-22(29)17-9-4-10-18(21(17)23(27)30)25-14-16-8-5-13-33-16/h1-7,9-10,13,16,19,25H,8,11-12,14H2,(H,26,28)(H,31,32) |
| InChIKey | XJPGBXNCXJESRH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|