About 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one
2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 71129507) has the molecular formula C16H23N5O
and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 71129507 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc2c(C)nc(N)nc2n(CCN2CCCCC2)c1=O |
| InChI | InChI=1S/C16H23N5O/c1-11-10-13-12(2)18-16(17)19-14(13)21(15(11)22)9-8-20-6-4-3-5-7-20/h10H,3-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | NHKMOHURMYXPEQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one (CID 71129507) is 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one is Cc1cc2c(C)nc(N)nc2n(CCN2CCCCC2)c1=O.
What is the InChIKey of 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is NHKMOHURMYXPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O/c1-11-10-13-12(2)18-16(17)19-14(13)21(15(11)22)9-8-20-6-4-3-5-7-20/h10H,3-9H2,1-2H3,(H2,17,18,19).
What are the key properties of 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 301.39 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 71129507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).