C26H36N2O2 — CID 71129517
(10aR)-6,6,9-trimethyl-3-[2-methyl-3-(pyrazol-1-ylmethyl)pentan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 71129517) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is (10aR)-6,6,9-trimethyl-3-[2-methyl-3-(pyrazol-1-ylmethyl)pentan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (10aR)-6,6,9-trimethyl-3-[2-methyl-3-(pyrazol-1-ylmethyl)pentan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 71129517 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (10aR)-6,6,9-trimethyl-3-[2-methyl-3-(pyrazol-1-ylmethyl)pentan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCC(Cn1cccn1)C(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(C)C[C@@H]21 |
| InChI | InChI=1S/C26H36N2O2/c1-7-18(16-28-12-8-11-27-28)25(3,4)19-14-22(29)24-20-13-17(2)9-10-21(20)26(5,6)30-23(24)15-19/h8-9,11-12,14-15,18,20-21,29H,7,10,13,16H2,1-6H3/t18?,20-,21?/m1/s1 |
| InChIKey | DPQNMNBBJBHJJA-VEDCXYSMSA-N |
| XLogP | 6.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|