C13H15ClFN3 — CID 71129625
(4S,5S)-5-(3-chloro-4-fluorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine (PubChem CID 71129625) has the molecular formula C13H15ClFN3 and a molecular weight of 267.74 g/mol. Its IUPAC name is (4S,5S)-5-(3-chloro-4-fluorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine.
| Compound Name | (4S,5S)-5-(3-chloro-4-fluorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine |
|---|---|
| PubChem CID | 71129625 |
| Molecular Formula | C13H15ClFN3 |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (4S,5S)-5-(3-chloro-4-fluorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine |
| SMILES | C[C@@H]1C2N=C(N)NC2C[C@@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFN3/c1-6-8(5-11-12(6)18-13(16)17-11)7-2-3-10(15)9(14)4-7/h2-4,6,8,11-12H,5H2,1H3,(H3,16,17,18)/t6-,8-,11?,12?/m0/s1 |
| InChIKey | SCJGQJHYNBZNTP-YXVUUKBZSA-N |
| XLogP | 2.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |