C19H32O2Si — CID 71129640
(4R,5R)-4,7-dimethyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-ol (PubChem CID 71129640) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (4R,5R)-4,7-dimethyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-ol.
| Compound Name | (4R,5R)-4,7-dimethyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-ol |
|---|---|
| PubChem CID | 71129640 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (4R,5R)-4,7-dimethyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](C)C2C=CC(O)C2=C(C)C12CC2 |
| InChI | InChI=1S/C19H32O2Si/c1-6-22(7-2,8-3)21-18-13(4)15-9-10-16(20)17(15)14(5)19(18)11-12-19/h9-10,13,15-16,18,20H,6-8,11-12H2,1-5H3/t13-,15?,16?,18-/m1/s1 |
| InChIKey | GDSFUEDUPOATFW-DVUZTRGUSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|