About 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone
1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone (PubChem CID 71130193) has the molecular formula C15H19ClN2O
and a molecular weight of 278.78 g/mol. Its IUPAC name is 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone |
| PubChem CID | 71130193 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone |
| SMILES | CC(=O)N1CC2(CCN(C)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H19ClN2O/c1-11(19)18-10-15(5-7-17(2)8-6-15)13-9-12(16)3-4-14(13)18/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | BEDURCXNWHLFEE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone?
The IUPAC name of 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone (CID 71130193) is 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone.
What is the SMILES notation for 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone?
The canonical SMILES for 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone is CC(=O)N1CC2(CCN(C)CC2)c2cc(Cl)ccc21.
What is the InChIKey of 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone?
The InChIKey is BEDURCXNWHLFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O/c1-11(19)18-10-15(5-7-17(2)8-6-15)13-9-12(16)3-4-14(13)18/h3-4,9H,5-8,10H2,1-2H3.
What are the key properties of 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone?
1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone has a molecular weight of 278.78 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanone is sourced from PubChem (CID 71130193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).