About tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate
tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 71130275) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate |
| PubChem CID | 71130275 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | CC/C=C/[C@@H]1[C@@H](C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-6-7-8-12-11(2)9-10-15(12)13(16)17-14(3,4)5/h7-8,11-12H,6,9-10H2,1-5H3/b8-7+/t11-,12+/m0/s1 |
| InChIKey | RNLWWTHGDXXCCX-ADYIUWEDSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate (CID 71130275) is tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate is CC/C=C/[C@@H]1[C@@H](C)CCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate?
The InChIKey is RNLWWTHGDXXCCX-ADYIUWEDSA-N. The full InChI is InChI=1S/C14H25NO2/c1-6-7-8-12-11(2)9-10-15(12)13(16)17-14(3,4)5/h7-8,11-12H,6,9-10H2,1-5H3/b8-7+/t11-,12+/m0/s1.
What are the key properties of tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate?
tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate has a molecular weight of 239.36 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,3S)-2-[(E)-but-1-enyl]-3-methylpyrrolidine-1-carboxylate is sourced from PubChem (CID 71130275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).