C22H16N2O5 — CID 7113050
dimethyl (2R,5S)-2,5-dicyano-2,5-diphenylfuran-3,4-dicarboxylate (PubChem CID 7113050) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is dimethyl (2R,5S)-2,5-dicyano-2,5-diphenylfuran-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,5S)-2,5-dicyano-2,5-diphenylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 7113050 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | dimethyl (2R,5S)-2,5-dicyano-2,5-diphenylfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@](C#N)(c2ccccc2)O[C@]1(C#N)c1ccccc1 |
| InChI | InChI=1S/C22H16N2O5/c1-27-19(25)17-18(20(26)28-2)22(14-24,16-11-7-4-8-12-16)29-21(17,13-23)15-9-5-3-6-10-15/h3-12H,1-2H3/t21-,22+ |
| InChIKey | ZROWRPTXENACIZ-SZPZYZBQSA-N |
| XLogP | 2.50 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |