C25H27N2OP — CID 71130666
(3aS,7aS)-1-benzyl-2,3-diphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole 2-oxide (PubChem CID 71130666) has the molecular formula C25H27N2OP and a molecular weight of 402.48 g/mol. Its IUPAC name is (3aS,7aS)-1-benzyl-2,3-diphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole 2-oxide.
| Compound Name | (3aS,7aS)-1-benzyl-2,3-diphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole 2-oxide |
|---|---|
| PubChem CID | 71130666 |
| Molecular Formula | C25H27N2OP |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (3aS,7aS)-1-benzyl-2,3-diphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole 2-oxide |
| SMILES | O=P1(c2ccccc2)N(Cc2ccccc2)[C@H]2CCCC[C@@H]2N1c1ccccc1 |
| InChI | InChI=1S/C25H27N2OP/c28-29(23-16-8-3-9-17-23)26(20-21-12-4-1-5-13-21)24-18-10-11-19-25(24)27(29)22-14-6-2-7-15-22/h1-9,12-17,24-25H,10-11,18-20H2/t24-,25-,29?/m0/s1 |
| InChIKey | SFBVSXWQQKFDSZ-CXBRBUDWSA-N |
| XLogP | 5.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|