C32H38N2O2P2 — CID 71130880
1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dipropylethane-1,1-diamine (PubChem CID 71130880) has the molecular formula C32H38N2O2P2 and a molecular weight of 544.62 g/mol. Its IUPAC name is 1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dipropylethane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dipropylethane-1,1-diamine |
|---|---|
| PubChem CID | 71130880 |
| Molecular Formula | C32H38N2O2P2 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dipropylethane-1,1-diamine |
| SMILES | CCCN(C(C)N(CCC)P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N2O2P2/c1-4-26-33(37(35,29-18-10-6-11-19-29)30-20-12-7-13-21-30)28(3)34(27-5-2)38(36,31-22-14-8-15-23-31)32-24-16-9-17-25-32/h6-25,28H,4-5,26-27H2,1-3H3 |
| InChIKey | MJZWAGDZNZXMML-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|