C28H30N2O2P2 — CID 71130902
1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dimethylethane-1,1-diamine (PubChem CID 71130902) has the molecular formula C28H30N2O2P2 and a molecular weight of 488.51 g/mol. Its IUPAC name is 1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dimethylethane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dimethylethane-1,1-diamine |
|---|---|
| PubChem CID | 71130902 |
| Molecular Formula | C28H30N2O2P2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 1-N,1-N'-bis(diphenylphosphoryl)-1-N,1-N'-dimethylethane-1,1-diamine |
| SMILES | CC(N(C)P(=O)(c1ccccc1)c1ccccc1)N(C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O2P2/c1-24(29(2)33(31,25-16-8-4-9-17-25)26-18-10-5-11-19-26)30(3)34(32,27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-24H,1-3H3 |
| InChIKey | PHQRVVWAUMHWAN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|