C39H63NO7Si — CID 71130913
N-[(2R,5R)-4,5-dibutoxy-6-(butoxymethyl)-2-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-3-yl]acetamide (PubChem CID 71130913) has the molecular formula C39H63NO7Si and a molecular weight of 686.02 g/mol. Its IUPAC name is N-[(2R,5R)-4,5-dibutoxy-6-(butoxymethyl)-2-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-3-yl]acetamide.
| Compound Name | N-[(2R,5R)-4,5-dibutoxy-6-(butoxymethyl)-2-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 71130913 |
| Molecular Formula | C39H63NO7Si |
| Molecular Weight | 686.02 g/mol |
| Exact Mass | 685.44 |
| IUPAC Name | N-[(2R,5R)-4,5-dibutoxy-6-(butoxymethyl)-2-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-3-yl]acetamide |
| SMILES | CCCCOCC1O[C@@H](OCCCCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)C(NC(C)=O)C(OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C39H63NO7Si/c1-7-10-26-43-30-34-36(44-27-11-8-2)37(45-28-12-9-3)35(40-31(4)41)38(47-34)46-29-20-19-25-39(5,6)48(42,32-21-15-13-16-22-32)33-23-17-14-18-24-33/h13-18,21-24,34-38,42H,7-12,19-20,25-30H2,1-6H3,(H,40,41)/t34?,35?,36-,37?,38+/m0/s1 |
| InChIKey | FLRXWEKQVUDZAX-KVJKUXNJSA-N |
| XLogP | 6.12 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.02 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|