C10H15NO2S — CID 71131093
5-methylsulfonyl-1,2,3,4,4a,8a-hexahydroquinoline (PubChem CID 71131093) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 5-methylsulfonyl-1,2,3,4,4a,8a-hexahydroquinoline.
| Compound Name | 5-methylsulfonyl-1,2,3,4,4a,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 71131093 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 5-methylsulfonyl-1,2,3,4,4a,8a-hexahydroquinoline |
| SMILES | CS(=O)(=O)C1=CC=CC2NCCCC12 |
| InChI | InChI=1S/C10H15NO2S/c1-14(12,13)10-6-2-5-9-8(10)4-3-7-11-9/h2,5-6,8-9,11H,3-4,7H2,1H3 |
| InChIKey | MRTRPEBQMVOWAC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |