C27H40N2O5S — CID 71131553
(1S,2S,6R,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-7-(methylamino)-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione (PubChem CID 71131553) has the molecular formula C27H40N2O5S and a molecular weight of 504.69 g/mol. Its IUPAC name is (1S,2S,6R,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-7-(methylamino)-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione.
| Compound Name | (1S,2S,6R,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-7-(methylamino)-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
|---|---|
| PubChem CID | 71131553 |
| Molecular Formula | C27H40N2O5S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (1S,2S,6R,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-7-(methylamino)-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-oxabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
| SMILES | CNC1/C=C(/C)CCC[C@@H]2C[C@](C)(C(=O)[C@H](C)[C@H]2O)[C@@H](O)CC(=O)O[C@@H]1/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C27H40N2O5S/c1-15-8-7-9-19-13-27(5,26(33)17(3)24(19)32)22(30)12-23(31)34-25(21(10-15)28-6)16(2)11-20-14-35-18(4)29-20/h10-11,14,17,19,21-22,24-25,28,30,32H,7-9,12-13H2,1-6H3/b15-10-,16-11+/t17-,19-,21?,22+,24-,25-,27+/m1/s1 |
| InChIKey | AXCSYDIPEYCIRR-CKJNMXSASA-N |
| XLogP | 3.83 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|