About 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane
2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane (PubChem CID 71131732) has the molecular formula C10H13F5
and a molecular weight of 228.20 g/mol. Its IUPAC name is 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane |
| PubChem CID | 71131732 |
| Molecular Formula | C10H13F5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane |
| SMILES | CC1C2CCC1C(C)(C(F)(F)F)C2(F)F |
| InChI | InChI=1S/C10H13F5/c1-5-6-3-4-7(5)9(11,12)8(6,2)10(13,14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | CQEYDESZIGSRBF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane?
The IUPAC name of 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane (CID 71131732) is 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane.
What is the SMILES notation for 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane?
The canonical SMILES for 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane is CC1C2CCC1C(C)(C(F)(F)F)C2(F)F.
What is the InChIKey of 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane?
The InChIKey is CQEYDESZIGSRBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F5/c1-5-6-3-4-7(5)9(11,12)8(6,2)10(13,14)15/h5-7H,3-4H2,1-2H3.
What are the key properties of 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane?
2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane has a molecular weight of 228.20 g/mol, XLogP of 3.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3,7-dimethyl-3-(trifluoromethyl)bicyclo[2.2.1]heptane is sourced from PubChem (CID 71131732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).