C20H17ClFNO4S — CID 71132193
2-[(3R)-4-[(4-chlorophenyl)methyl]-7-fluoro-5-sulfino-2,3-dihydro-1H-cyclopenta[b]indol-3-yl]acetic acid (PubChem CID 71132193) has the molecular formula C20H17ClFNO4S and a molecular weight of 421.88 g/mol. Its IUPAC name is 2-[(3R)-4-[(4-chlorophenyl)methyl]-7-fluoro-5-sulfino-2,3-dihydro-1H-cyclopenta[b]indol-3-yl]acetic acid.
| Compound Name | 2-[(3R)-4-[(4-chlorophenyl)methyl]-7-fluoro-5-sulfino-2,3-dihydro-1H-cyclopenta[b]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 71132193 |
| Molecular Formula | C20H17ClFNO4S |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2-[(3R)-4-[(4-chlorophenyl)methyl]-7-fluoro-5-sulfino-2,3-dihydro-1H-cyclopenta[b]indol-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CCc2c1n(Cc1ccc(Cl)cc1)c1c(S(=O)O)cc(F)cc21 |
| InChI | InChI=1S/C20H17ClFNO4S/c21-13-4-1-11(2-5-13)10-23-19-12(7-18(24)25)3-6-15(19)16-8-14(22)9-17(20(16)23)28(26)27/h1-2,4-5,8-9,12H,3,6-7,10H2,(H,24,25)(H,26,27)/t12-/m1/s1 |
| InChIKey | FXIHORXWQJVOIZ-GFCCVEGCSA-N |
| XLogP | 4.57 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|