C27H29F3N4O3 — CID 71132766
N-[2-[[cyclopropylidene-[1-phenyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]amino]ethyl]-3,5-diethoxybenzamide (PubChem CID 71132766) has the molecular formula C27H29F3N4O3 and a molecular weight of 514.55 g/mol. Its IUPAC name is N-[2-[[cyclopropylidene-[1-phenyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]amino]ethyl]-3,5-diethoxybenzamide.
| Compound Name | N-[2-[[cyclopropylidene-[1-phenyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]amino]ethyl]-3,5-diethoxybenzamide |
|---|---|
| PubChem CID | 71132766 |
| Molecular Formula | C27H29F3N4O3 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-[2-[[cyclopropylidene-[1-phenyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]amino]ethyl]-3,5-diethoxybenzamide |
| SMILES | CCOc1cc(OCC)cc(C(=O)NCCNC(=C2CC2)c2cn(-c3ccccc3)nc2C(F)(F)F)c1 |
| InChI | InChI=1S/C27H29F3N4O3/c1-3-36-21-14-19(15-22(16-21)37-4-2)26(35)32-13-12-31-24(18-10-11-18)23-17-34(20-8-6-5-7-9-20)33-25(23)27(28,29)30/h5-9,14-17,31H,3-4,10-13H2,1-2H3,(H,32,35) |
| InChIKey | CMBJRTZPUUAZBV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|